C24H31N6O2P — CID 25334027
(3R,4E)-N,N-diethyl-2-methyl-3-(2-nitrophenyl)imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine (PubChem CID 25334027) has the molecular formula C24H31N6O2P and a molecular weight of 466.53 g/mol. Its IUPAC name is (3R,4E)-N,N-diethyl-2-methyl-3-(2-nitrophenyl)imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine.
| Compound Name | (3R,4E)-N,N-diethyl-2-methyl-3-(2-nitrophenyl)imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
|---|---|
| PubChem CID | 25334027 |
| Molecular Formula | C24H31N6O2P |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (3R,4E)-N,N-diethyl-2-methyl-3-(2-nitrophenyl)imino-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
| SMILES | CCN(CC)[P@]1(=Nc2ccccc2[N+](=O)[O-])/C(=C2/N(C)c3ccccc3C2(C)C)C=NN1C |
| InChI | InChI=1S/C24H31N6O2P/c1-7-29(8-2)33(26-19-14-10-12-16-21(19)30(31)32)22(17-25-28(33)6)23-24(3,4)18-13-9-11-15-20(18)27(23)5/h9-17H,7-8H2,1-6H3/b23-22+/t33-/m0/s1 |
| InChIKey | GYXIURJUEDUNOA-ZNJGXVOXSA-N |
| XLogP | 6.17 |
| TPSA | 77.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|