C24H31BrN5P — CID 39923499
(3R,4Z)-3-(2-bromophenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine (PubChem CID 39923499) has the molecular formula C24H31BrN5P and a molecular weight of 500.43 g/mol. Its IUPAC name is (3R,4Z)-3-(2-bromophenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine.
| Compound Name | (3R,4Z)-3-(2-bromophenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
|---|---|
| PubChem CID | 39923499 |
| Molecular Formula | C24H31BrN5P |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | (3R,4Z)-3-(2-bromophenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
| SMILES | CCN(CC)[P@]1(=Nc2ccccc2Br)/C(=C2\N(C)c3ccccc3C2(C)C)C=NN1C |
| InChI | InChI=1S/C24H31BrN5P/c1-7-30(8-2)31(27-20-15-11-10-14-19(20)25)22(17-26-29(31)6)23-24(3,4)18-13-9-12-16-21(18)28(23)5/h9-17H,7-8H2,1-6H3/b23-22-/t31-/m0/s1 |
| InChIKey | YMCXXXLAGBGBLA-CXZHOCLDSA-N |
| XLogP | 7.02 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|