C26H36N5P — CID 25333938
(3S,4E)-3-(2,3-dimethylphenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine (PubChem CID 25333938) has the molecular formula C26H36N5P and a molecular weight of 449.58 g/mol. Its IUPAC name is (3S,4E)-3-(2,3-dimethylphenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine.
| Compound Name | (3S,4E)-3-(2,3-dimethylphenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
|---|---|
| PubChem CID | 25333938 |
| Molecular Formula | C26H36N5P |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (3S,4E)-3-(2,3-dimethylphenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
| SMILES | CCN(CC)[P@@]1(=Nc2cccc(C)c2C)/C(=C2/N(C)c3ccccc3C2(C)C)C=NN1C |
| InChI | InChI=1S/C26H36N5P/c1-9-31(10-2)32(28-22-16-13-14-19(3)20(22)4)24(18-27-30(32)8)25-26(5,6)21-15-11-12-17-23(21)29(25)7/h11-18H,9-10H2,1-8H3/b25-24+/t32-/m1/s1 |
| InChIKey | NQQKOQYSALBODT-RUEYHTOUSA-N |
| XLogP | 6.88 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|