C31H38N5P — CID 25334015
(3R,4E)-3-(2,3-dimethylphenyl)imino-N,N-diethyl-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine (PubChem CID 25334015) has the molecular formula C31H38N5P and a molecular weight of 511.65 g/mol. Its IUPAC name is (3R,4E)-3-(2,3-dimethylphenyl)imino-N,N-diethyl-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine.
| Compound Name | (3R,4E)-3-(2,3-dimethylphenyl)imino-N,N-diethyl-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
|---|---|
| PubChem CID | 25334015 |
| Molecular Formula | C31H38N5P |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | (3R,4E)-3-(2,3-dimethylphenyl)imino-N,N-diethyl-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
| SMILES | CCN(CC)[P@]1(=Nc2cccc(C)c2C)/C(=C2/N(C)c3ccccc3C2(C)C)C=NN1c1ccccc1 |
| InChI | InChI=1S/C31H38N5P/c1-8-35(9-2)37(33-27-20-15-16-23(3)24(27)4)29(22-32-36(37)25-17-11-10-12-18-25)30-31(5,6)26-19-13-14-21-28(26)34(30)7/h10-22H,8-9H2,1-7H3/b30-29+/t37-/m1/s1 |
| InChIKey | VZOYQCDUUUFGED-YAJVGSDYSA-N |
| XLogP | 8.45 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|