C21H25NO3 — CID 118652462
(3R,4S,7S)-7-amino-4-methyl-3-[(2-phenylphenyl)methyl]-1,5-dioxonan-6-one (PubChem CID 118652462) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3R,4S,7S)-7-amino-4-methyl-3-[(2-phenylphenyl)methyl]-1,5-dioxonan-6-one.
| Compound Name | (3R,4S,7S)-7-amino-4-methyl-3-[(2-phenylphenyl)methyl]-1,5-dioxonan-6-one |
|---|---|
| PubChem CID | 118652462 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (3R,4S,7S)-7-amino-4-methyl-3-[(2-phenylphenyl)methyl]-1,5-dioxonan-6-one |
| SMILES | C[C@@H]1OC(=O)[C@@H](N)CCOC[C@H]1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-15-18(14-24-12-11-20(22)21(23)25-15)13-17-9-5-6-10-19(17)16-7-3-2-4-8-16/h2-10,15,18,20H,11-14,22H2,1H3/t15-,18+,20-/m0/s1 |
| InChIKey | JYXQDSRAXHBFSP-CVAIRZPRSA-N |
| XLogP | 3.19 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |