C56H48N2O4 — CID 118655459
3,6-bis(10,10,14,21,21-pentamethyl-14-azapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaen-7-yl)furo[3,2-b]furan-2,5-dione (PubChem CID 118655459) has the molecular formula C56H48N2O4 and a molecular weight of 813.01 g/mol. Its IUPAC name is 3,6-bis(10,10,14,21,21-pentamethyl-14-azapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaen-7-yl)furo[3,2-b]furan-2,5-dione.
| Compound Name | 3,6-bis(10,10,14,21,21-pentamethyl-14-azapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaen-7-yl)furo[3,2-b]furan-2,5-dione |
|---|---|
| PubChem CID | 118655459 |
| Molecular Formula | C56H48N2O4 |
| Molecular Weight | 813.01 g/mol |
| Exact Mass | 812.36 |
| IUPAC Name | 3,6-bis(10,10,14,21,21-pentamethyl-14-azapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaen-7-yl)furo[3,2-b]furan-2,5-dione |
| SMILES | CN1c2ccccc2C(C)(C)c2cc3c(cc21)C(C)(C)c1cc(C2=C4OC(=O)C(c5ccc6c(c5)C(C)(C)c5cc7c(cc5-6)C(C)(C)c5ccccc5N7C)=C4OC2=O)ccc1-3 |
| InChI | InChI=1S/C56H48N2O4/c1-53(2)35-15-11-13-17-43(35)57(9)45-27-39-33(25-41(45)53)31-21-19-29(23-37(31)55(39,5)6)47-49-50(62-51(47)59)48(52(60)61-49)30-20-22-32-34-26-42-46(28-40(34)56(7,8)38(32)24-30)58(10)44-18-14-12-16-36(44)54(42,3)4/h11-28H,1-10H3 |
| InChIKey | KOAJXRIATJPMFI-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.01 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |