C21H21Cl2NO5S — CID 118656102
6-[(2,4-dichlorophenyl)methoxy]-N-(2-methoxyethyl)-3-(methoxymethoxy)-1-benzothiophene-2-carboxamide (PubChem CID 118656102) has the molecular formula C21H21Cl2NO5S and a molecular weight of 470.37 g/mol. Its IUPAC name is 6-[(2,4-dichlorophenyl)methoxy]-N-(2-methoxyethyl)-3-(methoxymethoxy)-1-benzothiophene-2-carboxamide.
| Compound Name | 6-[(2,4-dichlorophenyl)methoxy]-N-(2-methoxyethyl)-3-(methoxymethoxy)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 118656102 |
| Molecular Formula | C21H21Cl2NO5S |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 6-[(2,4-dichlorophenyl)methoxy]-N-(2-methoxyethyl)-3-(methoxymethoxy)-1-benzothiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1sc2cc(OCc3ccc(Cl)cc3Cl)ccc2c1OCOC |
| InChI | InChI=1S/C21H21Cl2NO5S/c1-26-8-7-24-21(25)20-19(29-12-27-2)16-6-5-15(10-18(16)30-20)28-11-13-3-4-14(22)9-17(13)23/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,24,25) |
| InChIKey | BHRBMXVMKINUDM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|