C5H12F4N2O4S2 — CID 118659626
N-ethylethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride (PubChem CID 118659626) has the molecular formula C5H12F4N2O4S2 and a molecular weight of 304.29 g/mol. Its IUPAC name is N-ethylethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride.
| Compound Name | N-ethylethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride |
|---|---|
| PubChem CID | 118659626 |
| Molecular Formula | C5H12F4N2O4S2 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | N-ethylethanamine;N-(trifluoromethylsulfonyl)sulfamoyl fluoride |
| SMILES | CCNCC.O=S(=O)(F)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H11N.CHF4NO4S2/c1-3-5-4-2;2-1(3,4)11(7,8)6-12(5,9)10/h5H,3-4H2,1-2H3;6H |
| InChIKey | XTEQBTQSBUQHHK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |