C21H21N3O3S — CID 11866059
(3R,8S,8aR)-8-(furan-2-ylmethylsulfanyl)-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 11866059) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is (3R,8S,8aR)-8-(furan-2-ylmethylsulfanyl)-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3R,8S,8aR)-8-(furan-2-ylmethylsulfanyl)-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 11866059 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | (3R,8S,8aR)-8-(furan-2-ylmethylsulfanyl)-3-(1H-indol-3-ylmethyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1N[C@H](Cc2c[nH]c3ccccc23)C(=O)N2CC[C@H](SCc3ccco3)[C@@H]12 |
| InChI | InChI=1S/C21H21N3O3S/c25-20-19-18(28-12-14-4-3-9-27-14)7-8-24(19)21(26)17(23-20)10-13-11-22-16-6-2-1-5-15(13)16/h1-6,9,11,17-19,22H,7-8,10,12H2,(H,23,25)/t17-,18+,19+/m1/s1 |
| InChIKey | ITARNFPPXFNSNF-QYZOEREBSA-N |
| XLogP | 2.70 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |