C28H36Cl2N6O2 — CID 118667411
6-amino-1-[4-[4-[6-amino-5-[1-(2,6-dichloro-3-methylphenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]hexan-1-one (PubChem CID 118667411) has the molecular formula C28H36Cl2N6O2 and a molecular weight of 559.54 g/mol. Its IUPAC name is 6-amino-1-[4-[4-[6-amino-5-[1-(2,6-dichloro-3-methylphenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]hexan-1-one.
| Compound Name | 6-amino-1-[4-[4-[6-amino-5-[1-(2,6-dichloro-3-methylphenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 118667411 |
| Molecular Formula | C28H36Cl2N6O2 |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 6-amino-1-[4-[4-[6-amino-5-[1-(2,6-dichloro-3-methylphenyl)ethoxy]-3-pyridinyl]pyrazol-1-yl]piperidin-1-yl]hexan-1-one |
| SMILES | Cc1ccc(Cl)c(C(C)Oc2cc(-c3cnn(C4CCN(C(=O)CCCCCN)CC4)c3)cnc2N)c1Cl |
| InChI | InChI=1S/C28H36Cl2N6O2/c1-18-7-8-23(29)26(27(18)30)19(2)38-24-14-20(15-33-28(24)32)21-16-34-36(17-21)22-9-12-35(13-10-22)25(37)6-4-3-5-11-31/h7-8,14-17,19,22H,3-6,9-13,31H2,1-2H3,(H2,32,33) |
| InChIKey | BGBRPJUIKVUHCN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|