C20H24Cl2N2O3 — CID 118675689
[(2S,3S)-3-(3-aminophenyl)-2-(3,4-dichlorophenyl)-3-hydroxypropyl]-tert-butylcarbamic acid (PubChem CID 118675689) has the molecular formula C20H24Cl2N2O3 and a molecular weight of 411.33 g/mol. Its IUPAC name is [(2S,3S)-3-(3-aminophenyl)-2-(3,4-dichlorophenyl)-3-hydroxypropyl]-tert-butylcarbamic acid.
| Compound Name | [(2S,3S)-3-(3-aminophenyl)-2-(3,4-dichlorophenyl)-3-hydroxypropyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 118675689 |
| Molecular Formula | C20H24Cl2N2O3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [(2S,3S)-3-(3-aminophenyl)-2-(3,4-dichlorophenyl)-3-hydroxypropyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C[C@H](c1ccc(Cl)c(Cl)c1)[C@H](O)c1cccc(N)c1)C(=O)O |
| InChI | InChI=1S/C20H24Cl2N2O3/c1-20(2,3)24(19(26)27)11-15(12-7-8-16(21)17(22)10-12)18(25)13-5-4-6-14(23)9-13/h4-10,15,18,25H,11,23H2,1-3H3,(H,26,27)/t15-,18-/m1/s1 |
| InChIKey | SMVZYCWKFFXZKS-CRAIPNDOSA-N |
| XLogP | 5.17 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|