C20H37N5O6 — CID 118677214
tert-butyl N-[1-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(2-methylprop-2-enoylamino)propylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 118677214) has the molecular formula C20H37N5O6 and a molecular weight of 443.55 g/mol. Its IUPAC name is tert-butyl N-[1-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(2-methylprop-2-enoylamino)propylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(2-methylprop-2-enoylamino)propylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 118677214 |
| Molecular Formula | C20H37N5O6 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | tert-butyl N-[1-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(2-methylprop-2-enoylamino)propylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C=C(C)C(=O)NCCCNC(CNC(=O)OC(C)(C)C)(NC(=O)OC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C20H37N5O6/c1-13(2)14(26)22-10-9-11-24-20(15(21)27,25-17(29)31-19(6,7)8)12-23-16(28)30-18(3,4)5/h24H,1,9-12H2,2-8H3,(H2,21,27)(H,22,26)(H,23,28)(H,25,29) |
| InChIKey | CRZXUPLRTYZJMJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|