C14H25N3O4 — CID 90205910
[2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethyl] N-tert-butylcarbamate (PubChem CID 90205910) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is [2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethyl] N-tert-butylcarbamate.
| Compound Name | [2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90205910 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | [2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethyl] N-tert-butylcarbamate |
| SMILES | C=C(C)C(=O)NCCCNC(=O)COC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H25N3O4/c1-10(2)12(19)16-8-6-7-15-11(18)9-21-13(20)17-14(3,4)5/h1,6-9H2,2-5H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | HZZGVDMXQPYGPY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|