C20H19N5O4S — CID 118680557
2-amino-5-[2-(3,4-dimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]-N-hydroxybenzeneamine oxide (PubChem CID 118680557) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-amino-5-[2-(3,4-dimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-amino-5-[2-(3,4-dimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 118680557 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-amino-5-[2-(3,4-dimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]-N-hydroxybenzeneamine oxide |
| SMILES | COc1ccc(Nc2ncc3scc(-c4ccc(N)c([NH+]([O-])O)c4)c3n2)cc1OC |
| InChI | InChI=1S/C20H19N5O4S/c1-28-16-6-4-12(8-17(16)29-2)23-20-22-9-18-19(24-20)13(10-30-18)11-3-5-14(21)15(7-11)25(26)27/h3-10,25-26H,21H2,1-2H3,(H,22,23,24) |
| InChIKey | ANGCNRUNSDVGIU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|