C23H22N4O4S — CID 164626714
N-methyl-2-[2-(3,4,5-trimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]benzamide (PubChem CID 164626714) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-methyl-2-[2-(3,4,5-trimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]benzamide.
| Compound Name | N-methyl-2-[2-(3,4,5-trimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]benzamide |
|---|---|
| PubChem CID | 164626714 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-methyl-2-[2-(3,4,5-trimethoxyanilino)thieno[3,2-d]pyrimidin-7-yl]benzamide |
| SMILES | CNC(=O)c1ccccc1-c1csc2cnc(Nc3cc(OC)c(OC)c(OC)c3)nc12 |
| InChI | InChI=1S/C23H22N4O4S/c1-24-22(28)15-8-6-5-7-14(15)16-12-32-19-11-25-23(27-20(16)19)26-13-9-17(29-2)21(31-4)18(10-13)30-3/h5-12H,1-4H3,(H,24,28)(H,25,26,27) |
| InChIKey | WFUMMLZHGTTYAJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |