C15H14ClN3O3S — CID 86673224
2-chloro-N-(3,4,5-trimethoxyphenyl)thieno[3,2-d]pyrimidin-7-amine (PubChem CID 86673224) has the molecular formula C15H14ClN3O3S and a molecular weight of 351.82 g/mol. Its IUPAC name is 2-chloro-N-(3,4,5-trimethoxyphenyl)thieno[3,2-d]pyrimidin-7-amine.
| Compound Name | 2-chloro-N-(3,4,5-trimethoxyphenyl)thieno[3,2-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 86673224 |
| Molecular Formula | C15H14ClN3O3S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-chloro-N-(3,4,5-trimethoxyphenyl)thieno[3,2-d]pyrimidin-7-amine |
| SMILES | COc1cc(Nc2csc3cnc(Cl)nc23)cc(OC)c1OC |
| InChI | InChI=1S/C15H14ClN3O3S/c1-20-10-4-8(5-11(21-2)14(10)22-3)18-9-7-23-12-6-17-15(16)19-13(9)12/h4-7,18H,1-3H3 |
| InChIKey | FTSHYVQXSWLNBJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |