About 5-sulfooxyhex-3-yn-2-yl sulfite
5-sulfooxyhex-3-yn-2-yl sulfite (PubChem CID 118684576) has the molecular formula C6H9O7S2-
and a molecular weight of 257.26 g/mol. Its IUPAC name is 5-sulfooxyhex-3-yn-2-yl sulfite.
Molecular Properties
| Compound Name | 5-sulfooxyhex-3-yn-2-yl sulfite |
| PubChem CID | 118684576 |
| Molecular Formula | C6H9O7S2- |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 5-sulfooxyhex-3-yn-2-yl sulfite |
| SMILES | CC(C#CC(C)OS(=O)(=O)O)OS(=O)[O-] |
| InChI | InChI=1S/C6H10O7S2/c1-5(12-14(7)8)3-4-6(2)13-15(9,10)11/h5-6H,1-2H3,(H,7,8)(H,9,10,11)/p-1 |
| InChIKey | ZARWPVJUJYSTCZ-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-sulfooxyhex-3-yn-2-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfooxyhex-3-yn-2-yl sulfite?
The IUPAC name of 5-sulfooxyhex-3-yn-2-yl sulfite (CID 118684576) is 5-sulfooxyhex-3-yn-2-yl sulfite.
What is the SMILES notation for 5-sulfooxyhex-3-yn-2-yl sulfite?
The canonical SMILES for 5-sulfooxyhex-3-yn-2-yl sulfite is CC(C#CC(C)OS(=O)(=O)O)OS(=O)[O-].
What is the InChIKey of 5-sulfooxyhex-3-yn-2-yl sulfite?
The InChIKey is ZARWPVJUJYSTCZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O7S2/c1-5(12-14(7)8)3-4-6(2)13-15(9,10)11/h5-6H,1-2H3,(H,7,8)(H,9,10,11)/p-1.
What are the key properties of 5-sulfooxyhex-3-yn-2-yl sulfite?
5-sulfooxyhex-3-yn-2-yl sulfite has a molecular weight of 257.26 g/mol, XLogP of -0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfooxyhex-3-yn-2-yl sulfite is sourced from PubChem (CID 118684576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).