C17H20ClF3N4O2 — CID 118692485
N-[5-chloro-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-[(2S)-6,6-dimethyloxan-2-yl]acetamide (PubChem CID 118692485) has the molecular formula C17H20ClF3N4O2 and a molecular weight of 404.82 g/mol. Its IUPAC name is N-[5-chloro-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-[(2S)-6,6-dimethyloxan-2-yl]acetamide.
| Compound Name | N-[5-chloro-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-[(2S)-6,6-dimethyloxan-2-yl]acetamide |
|---|---|
| PubChem CID | 118692485 |
| Molecular Formula | C17H20ClF3N4O2 |
| Molecular Weight | 404.82 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[5-chloro-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-[(2S)-6,6-dimethyloxan-2-yl]acetamide |
| SMILES | CC1(C)CCC[C@@H](CC(=O)Nc2nc3ccc(Cl)nc3n2CC(F)(F)F)O1 |
| InChI | InChI=1S/C17H20ClF3N4O2/c1-16(2)7-3-4-10(27-16)8-13(26)24-15-22-11-5-6-12(18)23-14(11)25(15)9-17(19,20)21/h5-6,10H,3-4,7-9H2,1-2H3,(H,22,24,26)/t10-/m0/s1 |
| InChIKey | BOTJOYXLXIWSCD-JTQLQIEISA-N |
| XLogP | 4.32 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.82 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|