C17H22ClFN4O2 — CID 118699453
N-[5-chloro-3-(2-fluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-(6,6-dimethyloxan-2-yl)acetamide (PubChem CID 118699453) has the molecular formula C17H22ClFN4O2 and a molecular weight of 368.84 g/mol. Its IUPAC name is N-[5-chloro-3-(2-fluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-(6,6-dimethyloxan-2-yl)acetamide.
| Compound Name | N-[5-chloro-3-(2-fluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-(6,6-dimethyloxan-2-yl)acetamide |
|---|---|
| PubChem CID | 118699453 |
| Molecular Formula | C17H22ClFN4O2 |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[5-chloro-3-(2-fluoroethyl)imidazo[4,5-b]pyridin-2-yl]-2-(6,6-dimethyloxan-2-yl)acetamide |
| SMILES | CC1(C)CCCC(CC(=O)Nc2nc3ccc(Cl)nc3n2CCF)O1 |
| InChI | InChI=1S/C17H22ClFN4O2/c1-17(2)7-3-4-11(25-17)10-14(24)22-16-20-12-5-6-13(18)21-15(12)23(16)9-8-19/h5-6,11H,3-4,7-10H2,1-2H3,(H,20,22,24) |
| InChIKey | NLJLQALQPQJXQC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|