C23H30ClN3O4S — CID 118695333
3-[4-aminobutyl(cyclohexyl)sulfamoyl]-N-(5-chloro-2-hydroxyphenyl)benzamide (PubChem CID 118695333) has the molecular formula C23H30ClN3O4S and a molecular weight of 480.03 g/mol. Its IUPAC name is 3-[4-aminobutyl(cyclohexyl)sulfamoyl]-N-(5-chloro-2-hydroxyphenyl)benzamide.
| Compound Name | 3-[4-aminobutyl(cyclohexyl)sulfamoyl]-N-(5-chloro-2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 118695333 |
| Molecular Formula | C23H30ClN3O4S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-[4-aminobutyl(cyclohexyl)sulfamoyl]-N-(5-chloro-2-hydroxyphenyl)benzamide |
| SMILES | NCCCCN(C1CCCCC1)S(=O)(=O)c1cccc(C(=O)Nc2cc(Cl)ccc2O)c1 |
| InChI | InChI=1S/C23H30ClN3O4S/c24-18-11-12-22(28)21(16-18)26-23(29)17-7-6-10-20(15-17)32(30,31)27(14-5-4-13-25)19-8-2-1-3-9-19/h6-7,10-12,15-16,19,28H,1-5,8-9,13-14,25H2,(H,26,29) |
| InChIKey | IRHFGYOUFPRAFX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|