C23H31N2NaO8 — CID 118704844
sodium 4-[(E)-N,N,N'-tris[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]benzoate (PubChem CID 118704844) has the molecular formula C23H31N2NaO8 and a molecular weight of 486.50 g/mol. Its IUPAC name is sodium 4-[(E)-N,N,N'-tris[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]benzoate.
| Compound Name | sodium 4-[(E)-N,N,N'-tris[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]benzoate |
|---|---|
| PubChem CID | 118704844 |
| Molecular Formula | C23H31N2NaO8 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | sodium 4-[(E)-N,N,N'-tris[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]benzoate |
| SMILES | CC(C)(C)OC(=O)/N=C(\c1ccc(C(=O)[O-])cc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.[Na+] |
| InChI | InChI=1S/C23H32N2O8.Na/c1-21(2,3)31-18(28)24-16(14-10-12-15(13-11-14)17(26)27)25(19(29)32-22(4,5)6)20(30)33-23(7,8)9;/h10-13H,1-9H3,(H,26,27);/q;+1/p-1/b24-16+; |
| InChIKey | APOLWGSOWJIPFP-RSOFWHLMSA-M |
| XLogP | 0.91 |
| TPSA | 134.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|