C20H12O5S — CID 118707760
8-hydroxy-2-(4-methoxybenzoyl)benzo[f][1]benzothiole-4,9-dione (PubChem CID 118707760) has the molecular formula C20H12O5S and a molecular weight of 364.38 g/mol. Its IUPAC name is 8-hydroxy-2-(4-methoxybenzoyl)benzo[f][1]benzothiole-4,9-dione.
| Compound Name | 8-hydroxy-2-(4-methoxybenzoyl)benzo[f][1]benzothiole-4,9-dione |
|---|---|
| PubChem CID | 118707760 |
| Molecular Formula | C20H12O5S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 8-hydroxy-2-(4-methoxybenzoyl)benzo[f][1]benzothiole-4,9-dione |
| SMILES | COc1ccc(C(=O)c2cc3c(s2)C(=O)c2c(O)cccc2C3=O)cc1 |
| InChI | InChI=1S/C20H12O5S/c1-25-11-7-5-10(6-8-11)17(22)15-9-13-18(23)12-3-2-4-14(21)16(12)19(24)20(13)26-15/h2-9,21H,1H3 |
| InChIKey | LUOAPPNWWKQHMS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|