C24H20O4 — CID 67584379
1,8-dihydroxy-10-[1-(4-methoxyphenyl)propylidene]anthracen-9-one (PubChem CID 67584379) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1,8-dihydroxy-10-[1-(4-methoxyphenyl)propylidene]anthracen-9-one.
| Compound Name | 1,8-dihydroxy-10-[1-(4-methoxyphenyl)propylidene]anthracen-9-one |
|---|---|
| PubChem CID | 67584379 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1,8-dihydroxy-10-[1-(4-methoxyphenyl)propylidene]anthracen-9-one |
| SMILES | CCC(=C1c2cccc(O)c2C(=O)c2c(O)cccc21)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H20O4/c1-3-16(14-10-12-15(28-2)13-11-14)21-17-6-4-8-19(25)22(17)24(27)23-18(21)7-5-9-20(23)26/h4-13,25-26H,3H2,1-2H3 |
| InChIKey | GWBYRARBRXPEAP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|