C22H14N2O6 — CID 11871067
(1S,3aR,6aR)-3-(1,3-dioxoinden-2-yl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylic acid (PubChem CID 11871067) has the molecular formula C22H14N2O6 and a molecular weight of 402.36 g/mol. Its IUPAC name is (1S,3aR,6aR)-3-(1,3-dioxoinden-2-yl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylic acid.
| Compound Name | (1S,3aR,6aR)-3-(1,3-dioxoinden-2-yl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 11871067 |
| Molecular Formula | C22H14N2O6 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (1S,3aR,6aR)-3-(1,3-dioxoinden-2-yl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylic acid |
| SMILES | O=C1c2ccccc2C(=O)C1C1=N[C@H](C(=O)O)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C22H14N2O6/c25-18-11-8-4-5-9-12(11)19(26)15(18)16-13-14(17(23-16)22(29)30)21(28)24(20(13)27)10-6-2-1-3-7-10/h1-9,13-15,17H,(H,29,30)/t13-,14-,17+/m1/s1 |
| InChIKey | JDMKTAIMLPXPQR-CPUCHLNUSA-N |
| XLogP | 1.40 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|