C24H17ClN2O6 — CID 136756361
ethyl (1R,3aR,6aR)-5-(4-chlorophenyl)-3-(1-hydroxy-3-oxoinden-2-yl)-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylate (PubChem CID 136756361) has the molecular formula C24H17ClN2O6 and a molecular weight of 464.86 g/mol. Its IUPAC name is ethyl (1R,3aR,6aR)-5-(4-chlorophenyl)-3-(1-hydroxy-3-oxoinden-2-yl)-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylate.
| Compound Name | ethyl (1R,3aR,6aR)-5-(4-chlorophenyl)-3-(1-hydroxy-3-oxoinden-2-yl)-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 136756361 |
| Molecular Formula | C24H17ClN2O6 |
| Molecular Weight | 464.86 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | ethyl (1R,3aR,6aR)-5-(4-chlorophenyl)-3-(1-hydroxy-3-oxoinden-2-yl)-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1N=C(C2=C(O)c3ccccc3C2=O)[C@@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C24H17ClN2O6/c1-2-33-24(32)19-16-15(22(30)27(23(16)31)12-9-7-11(25)8-10-12)18(26-19)17-20(28)13-5-3-4-6-14(13)21(17)29/h3-10,15-16,19,28H,2H2,1H3/t15-,16-,19-/m1/s1 |
| InChIKey | CIZCQFBTWVCDMT-GPMSIDNRSA-N |
| XLogP | 3.00 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|