C27H26Cl2N4OS — CID 118713339
1-[[4-(1-adamantyl)quinoline-2-carbonyl]amino]-3-(2,5-dichlorophenyl)thiourea (PubChem CID 118713339) has the molecular formula C27H26Cl2N4OS and a molecular weight of 525.51 g/mol. Its IUPAC name is 1-[[4-(1-adamantyl)quinoline-2-carbonyl]amino]-3-(2,5-dichlorophenyl)thiourea.
| Compound Name | 1-[[4-(1-adamantyl)quinoline-2-carbonyl]amino]-3-(2,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 118713339 |
| Molecular Formula | C27H26Cl2N4OS |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 1-[[4-(1-adamantyl)quinoline-2-carbonyl]amino]-3-(2,5-dichlorophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1cc(Cl)ccc1Cl)c1cc(C23CC4CC(CC(C4)C2)C3)c2ccccc2n1 |
| InChI | InChI=1S/C27H26Cl2N4OS/c28-18-5-6-21(29)23(10-18)31-26(35)33-32-25(34)24-11-20(19-3-1-2-4-22(19)30-24)27-12-15-7-16(13-27)9-17(8-15)14-27/h1-6,10-11,15-17H,7-9,12-14H2,(H,32,34)(H2,31,33,35) |
| InChIKey | YGHQQZLPQSXXQD-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|