C29H32N4O3S — CID 118713338
1-[[4-(1-adamantyl)quinoline-2-carbonyl]amino]-3-(2,5-dimethoxyphenyl)thiourea (PubChem CID 118713338) has the molecular formula C29H32N4O3S and a molecular weight of 516.67 g/mol. Its IUPAC name is 1-[[4-(1-adamantyl)quinoline-2-carbonyl]amino]-3-(2,5-dimethoxyphenyl)thiourea.
| Compound Name | 1-[[4-(1-adamantyl)quinoline-2-carbonyl]amino]-3-(2,5-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 118713338 |
| Molecular Formula | C29H32N4O3S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 1-[[4-(1-adamantyl)quinoline-2-carbonyl]amino]-3-(2,5-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)NNC(=O)c2cc(C34CC5CC(CC(C5)C3)C4)c3ccccc3n2)c1 |
| InChI | InChI=1S/C29H32N4O3S/c1-35-20-7-8-26(36-2)24(12-20)31-28(37)33-32-27(34)25-13-22(21-5-3-4-6-23(21)30-25)29-14-17-9-18(15-29)11-19(10-17)16-29/h3-8,12-13,17-19H,9-11,14-16H2,1-2H3,(H,32,34)(H2,31,33,37) |
| InChIKey | NBQVBGOTPZZHFK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|