C26H24O6 — CID 118714874
(E)-3-[4-[3-(3-hydroxyphenyl)propanoyloxy]-3-[(4-methylphenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 118714874) has the molecular formula C26H24O6 and a molecular weight of 432.47 g/mol. Its IUPAC name is (E)-3-[4-[3-(3-hydroxyphenyl)propanoyloxy]-3-[(4-methylphenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(3-hydroxyphenyl)propanoyloxy]-3-[(4-methylphenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118714874 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (E)-3-[4-[3-(3-hydroxyphenyl)propanoyloxy]-3-[(4-methylphenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(COc2cc(/C=C/C(=O)O)ccc2OC(=O)CCc2cccc(O)c2)cc1 |
| InChI | InChI=1S/C26H24O6/c1-18-5-7-21(8-6-18)17-31-24-16-20(10-13-25(28)29)9-12-23(24)32-26(30)14-11-19-3-2-4-22(27)15-19/h2-10,12-13,15-16,27H,11,14,17H2,1H3,(H,28,29)/b13-10+ |
| InChIKey | REXCTPLATXMIIV-JLHYYAGUSA-N |
| XLogP | 4.92 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|