C24H27ClN2O4 — CID 118715798
N-[(E)-(5-chloro-2,3-dimethyl-8,9-dihydro-7H-benzo[7]annulen-6-yl)methylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 118715798) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2,3-dimethyl-8,9-dihydro-7H-benzo[7]annulen-6-yl)methylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(E)-(5-chloro-2,3-dimethyl-8,9-dihydro-7H-benzo[7]annulen-6-yl)methylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 118715798 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[(E)-(5-chloro-2,3-dimethyl-8,9-dihydro-7H-benzo[7]annulen-6-yl)methylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C/C2=C(Cl)c3cc(C)c(C)cc3CCC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H27ClN2O4/c1-14-9-16-7-6-8-17(22(25)19(16)10-15(14)2)13-26-27-24(28)18-11-20(29-3)23(31-5)21(12-18)30-4/h9-13H,6-8H2,1-5H3,(H,27,28)/b26-13+ |
| InChIKey | RUXXDWCHRZKKMF-LGJNPRDNSA-N |
| XLogP | 5.03 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|