C18H22F3N5O2 — CID 118720640
(1R)-9-[(1,3-dimethylazetidin-3-yl)-methylamino]-1-methyl-8-(trifluoromethyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 118720640) has the molecular formula C18H22F3N5O2 and a molecular weight of 397.40 g/mol. Its IUPAC name is (1R)-9-[(1,3-dimethylazetidin-3-yl)-methylamino]-1-methyl-8-(trifluoromethyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | (1R)-9-[(1,3-dimethylazetidin-3-yl)-methylamino]-1-methyl-8-(trifluoromethyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 118720640 |
| Molecular Formula | C18H22F3N5O2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (1R)-9-[(1,3-dimethylazetidin-3-yl)-methylamino]-1-methyl-8-(trifluoromethyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | C[C@@H]1C(=O)NN=C2COc3cc(C(F)(F)F)c(N(C)C4(C)CN(C)C4)cc3N21 |
| InChI | InChI=1S/C18H22F3N5O2/c1-10-16(27)23-22-15-7-28-14-5-11(18(19,20)21)12(6-13(14)26(10)15)25(4)17(2)8-24(3)9-17/h5-6,10H,7-9H2,1-4H3,(H,23,27)/t10-/m1/s1 |
| InChIKey | LFKQXDRWWTVIRU-SNVBAGLBSA-N |
| XLogP | 1.88 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|