C19H26F3N3O3 — CID 118721306
(3aR,6aS)-5-[5-[(1S,2R)-2-(2-methoxyethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 118721306) has the molecular formula C19H26F3N3O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is (3aR,6aS)-5-[5-[(1S,2R)-2-(2-methoxyethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aS)-5-[5-[(1S,2R)-2-(2-methoxyethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118721306 |
| Molecular Formula | C19H26F3N3O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (3aR,6aS)-5-[5-[(1S,2R)-2-(2-methoxyethyl)cyclopropyl]-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | COCC[C@H]1C[C@@H]1c1cncc(N2C[C@H]3CNC[C@H]3C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O.C2HF3O2/c1-21-3-2-12-5-17(12)13-4-16(9-19-6-13)20-10-14-7-18-8-15(14)11-20;3-2(4,5)1(6)7/h4,6,9,12,14-15,17-18H,2-3,5,7-8,10-11H2,1H3;(H,6,7)/t12-,14-,15+,17-;/m0./s1 |
| InChIKey | CDZHPTFDWGBHGA-YIVBMFOKSA-N |
| XLogP | 2.51 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |