C18H22BrFN2O5S — CID 118723324
7-bromo-1-(4-fluorobutyl)-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione (PubChem CID 118723324) has the molecular formula C18H22BrFN2O5S and a molecular weight of 477.35 g/mol. Its IUPAC name is 7-bromo-1-(4-fluorobutyl)-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione.
| Compound Name | 7-bromo-1-(4-fluorobutyl)-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 118723324 |
| Molecular Formula | C18H22BrFN2O5S |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 7-bromo-1-(4-fluorobutyl)-5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
| SMILES | COC[C@@H]1CCCN1S(=O)(=O)c1cc(Br)c2c(c1)C(=O)C(=O)N2CCCCF |
| InChI | InChI=1S/C18H22BrFN2O5S/c1-27-11-12-5-4-8-22(12)28(25,26)13-9-14-16(15(19)10-13)21(7-3-2-6-20)18(24)17(14)23/h9-10,12H,2-8,11H2,1H3/t12-/m0/s1 |
| InChIKey | LHHQIZSDNGIYTJ-LBPRGKRZSA-N |
| XLogP | 2.53 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|