C28H28N2O5S — CID 22456680
5-[2-(phenoxymethyl)pyrrolidin-1-yl]sulfonyl-1-(3-phenylpropyl)indole-2,3-dione (PubChem CID 22456680) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is 5-[2-(phenoxymethyl)pyrrolidin-1-yl]sulfonyl-1-(3-phenylpropyl)indole-2,3-dione.
| Compound Name | 5-[2-(phenoxymethyl)pyrrolidin-1-yl]sulfonyl-1-(3-phenylpropyl)indole-2,3-dione |
|---|---|
| PubChem CID | 22456680 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 5-[2-(phenoxymethyl)pyrrolidin-1-yl]sulfonyl-1-(3-phenylpropyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCc2ccccc2)c2ccc(S(=O)(=O)N3CCCC3COc3ccccc3)cc21 |
| InChI | InChI=1S/C28H28N2O5S/c31-27-25-19-24(15-16-26(25)29(28(27)32)17-7-11-21-9-3-1-4-10-21)36(33,34)30-18-8-12-22(30)20-35-23-13-5-2-6-14-23/h1-6,9-10,13-16,19,22H,7-8,11-12,17-18,20H2 |
| InChIKey | YIELYEVAOWYXJC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|