C33H30N2O6S — CID 68907020
5-[2-(phenoxymethyl)pyrrolidin-1-yl]sulfonyl-1-[(4-phenylmethoxyphenyl)methyl]indole-2,3-dione (PubChem CID 68907020) has the molecular formula C33H30N2O6S and a molecular weight of 582.68 g/mol. Its IUPAC name is 5-[2-(phenoxymethyl)pyrrolidin-1-yl]sulfonyl-1-[(4-phenylmethoxyphenyl)methyl]indole-2,3-dione.
| Compound Name | 5-[2-(phenoxymethyl)pyrrolidin-1-yl]sulfonyl-1-[(4-phenylmethoxyphenyl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 68907020 |
| Molecular Formula | C33H30N2O6S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | 5-[2-(phenoxymethyl)pyrrolidin-1-yl]sulfonyl-1-[(4-phenylmethoxyphenyl)methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccc(OCc3ccccc3)cc2)c2ccc(S(=O)(=O)N3CCCC3COc3ccccc3)cc21 |
| InChI | InChI=1S/C33H30N2O6S/c36-32-30-20-29(42(38,39)35-19-7-10-26(35)23-41-27-11-5-2-6-12-27)17-18-31(30)34(33(32)37)21-24-13-15-28(16-14-24)40-22-25-8-3-1-4-9-25/h1-6,8-9,11-18,20,26H,7,10,19,21-23H2 |
| InChIKey | TYNSYLVNJGBPDH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|