C22H20F3IN2O5S — CID 11678833
1-[2-(4-iodophenyl)ethyl]-5-[(2S)-2-(trifluoromethoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione (PubChem CID 11678833) has the molecular formula C22H20F3IN2O5S and a molecular weight of 604.38 g/mol. Its IUPAC name is 1-[2-(4-iodophenyl)ethyl]-5-[(2S)-2-(trifluoromethoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione.
| Compound Name | 1-[2-(4-iodophenyl)ethyl]-5-[(2S)-2-(trifluoromethoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 11678833 |
| Molecular Formula | C22H20F3IN2O5S |
| Molecular Weight | 604.38 g/mol |
| Exact Mass | 604.01 |
| IUPAC Name | 1-[2-(4-iodophenyl)ethyl]-5-[(2S)-2-(trifluoromethoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
| SMILES | O=C1C(=O)N(CCc2ccc([123I])cc2)c2ccc(S(=O)(=O)N3CCC[C@H]3COC(F)(F)F)cc21 |
| InChI | InChI=1S/C22H20F3IN2O5S/c23-22(24,25)33-13-16-2-1-10-28(16)34(31,32)17-7-8-19-18(12-17)20(29)21(30)27(19)11-9-14-3-5-15(26)6-4-14/h3-8,12,16H,1-2,9-11,13H2/t16-/m0/s1/i26-4 |
| InChIKey | QLKOKLXVONOTDF-LRKHGEFISA-N |
| XLogP | 3.75 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|