C20H25N5O4S — CID 58384195
1-ethyl-2-methylidene-5-[(2S)-2-[(1-(111C)methyltriazol-4-yl)methoxymethyl]pyrrolidin-1-yl]sulfonylindol-3-one (PubChem CID 58384195) has the molecular formula C20H25N5O4S and a molecular weight of 430.52 g/mol. Its IUPAC name is 1-ethyl-2-methylidene-5-[(2S)-2-[(1-(111C)methyltriazol-4-yl)methoxymethyl]pyrrolidin-1-yl]sulfonylindol-3-one.
| Compound Name | 1-ethyl-2-methylidene-5-[(2S)-2-[(1-(111C)methyltriazol-4-yl)methoxymethyl]pyrrolidin-1-yl]sulfonylindol-3-one |
|---|---|
| PubChem CID | 58384195 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-ethyl-2-methylidene-5-[(2S)-2-[(1-(111C)methyltriazol-4-yl)methoxymethyl]pyrrolidin-1-yl]sulfonylindol-3-one |
| SMILES | C=C1C(=O)c2cc(S(=O)(=O)N3CCC[C@H]3COCc3cn([11CH3])nn3)ccc2N1CC |
| InChI | InChI=1S/C20H25N5O4S/c1-4-24-14(2)20(26)18-10-17(7-8-19(18)24)30(27,28)25-9-5-6-16(25)13-29-12-15-11-23(3)22-21-15/h7-8,10-11,16H,2,4-6,9,12-13H2,1,3H3/t16-/m0/s1/i3-1 |
| InChIKey | SFFXVQORADUNSS-NAZUFDMFSA-N |
| XLogP | 1.72 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|