C20H28N2O5S — CID 71582975
1-butyl-5-[2-(3-methoxypropyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione (PubChem CID 71582975) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-butyl-5-[2-(3-methoxypropyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione.
| Compound Name | 1-butyl-5-[2-(3-methoxypropyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 71582975 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-butyl-5-[2-(3-methoxypropyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
| SMILES | CCCCN1C(=O)C(=O)c2cc(S(=O)(=O)N3CCCC3CCCOC)ccc21 |
| InChI | InChI=1S/C20H28N2O5S/c1-3-4-11-21-18-10-9-16(14-17(18)19(23)20(21)24)28(25,26)22-12-5-7-15(22)8-6-13-27-2/h9-10,14-15H,3-8,11-13H2,1-2H3 |
| InChIKey | VOOBNDVVTJIXRQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|