C27H25IN2O6S — CID 11635896
1-[2-(4-hydroxy-3-(123I)iodophenyl)ethyl]-5-[(2S)-2-(phenoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione (PubChem CID 11635896) has the molecular formula C27H25IN2O6S and a molecular weight of 628.48 g/mol. Its IUPAC name is 1-[2-(4-hydroxy-3-(123I)iodophenyl)ethyl]-5-[(2S)-2-(phenoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione.
| Compound Name | 1-[2-(4-hydroxy-3-(123I)iodophenyl)ethyl]-5-[(2S)-2-(phenoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 11635896 |
| Molecular Formula | C27H25IN2O6S |
| Molecular Weight | 628.48 g/mol |
| Exact Mass | 628.05 |
| IUPAC Name | 1-[2-(4-hydroxy-3-(123I)iodophenyl)ethyl]-5-[(2S)-2-(phenoxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
| SMILES | O=C1C(=O)N(CCc2ccc(O)c([123I])c2)c2ccc(S(=O)(=O)N3CCC[C@H]3COc3ccccc3)cc21 |
| InChI | InChI=1S/C27H25IN2O6S/c28-23-15-18(8-11-25(23)31)12-14-29-24-10-9-21(16-22(24)26(32)27(29)33)37(34,35)30-13-4-5-19(30)17-36-20-6-2-1-3-7-20/h1-3,6-11,15-16,19,31H,4-5,12-14,17H2/t19-/m0/s1/i28-4 |
| InChIKey | IIOGYUUEUUXLLT-KHOXMBEZSA-N |
| XLogP | 4.00 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|