C27H21N5O5S — CID 89283915
2-[1-[(4-hydroxyphenyl)methyl]-2-oxo-5-[(2S)-2-(pyridin-3-yloxymethyl)azetidin-1-yl]sulfonylindol-3-ylidene]propanedinitrile (PubChem CID 89283915) has the molecular formula C27H21N5O5S and a molecular weight of 527.56 g/mol. Its IUPAC name is 2-[1-[(4-hydroxyphenyl)methyl]-2-oxo-5-[(2S)-2-(pyridin-3-yloxymethyl)azetidin-1-yl]sulfonylindol-3-ylidene]propanedinitrile.
| Compound Name | 2-[1-[(4-hydroxyphenyl)methyl]-2-oxo-5-[(2S)-2-(pyridin-3-yloxymethyl)azetidin-1-yl]sulfonylindol-3-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 89283915 |
| Molecular Formula | C27H21N5O5S |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 2-[1-[(4-hydroxyphenyl)methyl]-2-oxo-5-[(2S)-2-(pyridin-3-yloxymethyl)azetidin-1-yl]sulfonylindol-3-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C(=O)N(Cc2ccc(O)cc2)c2ccc(S(=O)(=O)N3CC[C@H]3COc3cccnc3)cc21 |
| InChI | InChI=1S/C27H21N5O5S/c28-13-19(14-29)26-24-12-23(7-8-25(24)31(27(26)34)16-18-3-5-21(33)6-4-18)38(35,36)32-11-9-20(32)17-37-22-2-1-10-30-15-22/h1-8,10,12,15,20,33H,9,11,16-17H2/t20-/m0/s1 |
| InChIKey | HDFASPZHNJTLPZ-FQEVSTJZSA-N |
| XLogP | 2.98 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|