C31H33FN2O8S — CID 54586343
1-[[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]methyl]-5-[(2S)-2-(phenoxymethyl)azetidin-1-yl]sulfonylindole-2,3-dione (PubChem CID 54586343) has the molecular formula C31H33FN2O8S and a molecular weight of 612.68 g/mol. Its IUPAC name is 1-[[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]methyl]-5-[(2S)-2-(phenoxymethyl)azetidin-1-yl]sulfonylindole-2,3-dione.
| Compound Name | 1-[[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]methyl]-5-[(2S)-2-(phenoxymethyl)azetidin-1-yl]sulfonylindole-2,3-dione |
|---|---|
| PubChem CID | 54586343 |
| Molecular Formula | C31H33FN2O8S |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | 1-[[4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]methyl]-5-[(2S)-2-(phenoxymethyl)azetidin-1-yl]sulfonylindole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccc(OCCOCCOCCF)cc2)c2ccc(S(=O)(=O)N3CC[C@H]3COc3ccccc3)cc21 |
| InChI | InChI=1S/C31H33FN2O8S/c32-13-15-39-16-17-40-18-19-41-26-8-6-23(7-9-26)21-33-29-11-10-27(20-28(29)30(35)31(33)36)43(37,38)34-14-12-24(34)22-42-25-4-2-1-3-5-25/h1-11,20,24H,12-19,21-22H2/t24-/m0/s1 |
| InChIKey | RHNPIGHUWVOJIW-DEOSSOPVSA-N |
| XLogP | 3.64 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|