C20H16ClN3O4 — CID 118724365
N-(4-chloro-3-methoxyphenyl)-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)propanamide (PubChem CID 118724365) has the molecular formula C20H16ClN3O4 and a molecular weight of 397.82 g/mol. Its IUPAC name is N-(4-chloro-3-methoxyphenyl)-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)propanamide.
| Compound Name | N-(4-chloro-3-methoxyphenyl)-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 118724365 |
| Molecular Formula | C20H16ClN3O4 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-(4-chloro-3-methoxyphenyl)-2-(4-oxochromeno[3,4-d]pyrazol-1-yl)propanamide |
| SMILES | COc1cc(NC(=O)C(C)n2ncc3c(=O)oc4ccccc4c32)ccc1Cl |
| InChI | InChI=1S/C20H16ClN3O4/c1-11(19(25)23-12-7-8-15(21)17(9-12)27-2)24-18-13-5-3-4-6-16(13)28-20(26)14(18)10-22-24/h3-11H,1-2H3,(H,23,25) |
| InChIKey | RPUUERRTFZTESM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|