C27H24Cl2N4O3 — CID 118726087
3-[3-[[4,6-bis(4-chlorophenyl)pyrimidin-2-yl]amino]phenoxy]-N-methoxy-N-methylpropanamide (PubChem CID 118726087) has the molecular formula C27H24Cl2N4O3 and a molecular weight of 523.42 g/mol. Its IUPAC name is 3-[3-[[4,6-bis(4-chlorophenyl)pyrimidin-2-yl]amino]phenoxy]-N-methoxy-N-methylpropanamide.
| Compound Name | 3-[3-[[4,6-bis(4-chlorophenyl)pyrimidin-2-yl]amino]phenoxy]-N-methoxy-N-methylpropanamide |
|---|---|
| PubChem CID | 118726087 |
| Molecular Formula | C27H24Cl2N4O3 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 3-[3-[[4,6-bis(4-chlorophenyl)pyrimidin-2-yl]amino]phenoxy]-N-methoxy-N-methylpropanamide |
| SMILES | CON(C)C(=O)CCOc1cccc(Nc2nc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C27H24Cl2N4O3/c1-33(35-2)26(34)14-15-36-23-5-3-4-22(16-23)30-27-31-24(18-6-10-20(28)11-7-18)17-25(32-27)19-8-12-21(29)13-9-19/h3-13,16-17H,14-15H2,1-2H3,(H,30,31,32) |
| InChIKey | ZAZXEPYPDNLRRR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|