C14H14INO4 — CID 118731047
2-[(3R)-4-methylidene-5-oxooxolan-3-yl]ethyl N-(4-iodophenyl)carbamate (PubChem CID 118731047) has the molecular formula C14H14INO4 and a molecular weight of 387.17 g/mol. Its IUPAC name is 2-[(3R)-4-methylidene-5-oxooxolan-3-yl]ethyl N-(4-iodophenyl)carbamate.
| Compound Name | 2-[(3R)-4-methylidene-5-oxooxolan-3-yl]ethyl N-(4-iodophenyl)carbamate |
|---|---|
| PubChem CID | 118731047 |
| Molecular Formula | C14H14INO4 |
| Molecular Weight | 387.17 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 2-[(3R)-4-methylidene-5-oxooxolan-3-yl]ethyl N-(4-iodophenyl)carbamate |
| SMILES | C=C1C(=O)OC[C@@H]1CCOC(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C14H14INO4/c1-9-10(8-20-13(9)17)6-7-19-14(18)16-12-4-2-11(15)3-5-12/h2-5,10H,1,6-8H2,(H,16,18)/t10-/m0/s1 |
| InChIKey | OLPFSGAIEMBSBD-JTQLQIEISA-N |
| XLogP | 2.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|