C19H23NO6 — CID 118731049
butyl 4-[2-[(3R)-4-methylidene-5-oxooxolan-3-yl]ethoxycarbonylamino]benzoate (PubChem CID 118731049) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is butyl 4-[2-[(3R)-4-methylidene-5-oxooxolan-3-yl]ethoxycarbonylamino]benzoate.
| Compound Name | butyl 4-[2-[(3R)-4-methylidene-5-oxooxolan-3-yl]ethoxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 118731049 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | butyl 4-[2-[(3R)-4-methylidene-5-oxooxolan-3-yl]ethoxycarbonylamino]benzoate |
| SMILES | C=C1C(=O)OC[C@@H]1CCOC(=O)Nc1ccc(C(=O)OCCCC)cc1 |
| InChI | InChI=1S/C19H23NO6/c1-3-4-10-24-18(22)14-5-7-16(8-6-14)20-19(23)25-11-9-15-12-26-17(21)13(15)2/h5-8,15H,2-4,9-12H2,1H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | KRSUXOPBRJANON-HNNXBMFYSA-N |
| XLogP | 3.31 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|