C26H23ClN4O6 — CID 118731963
N'-(2-chlorophenyl)-N-[4-methoxy-2-[[4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]phenyl]oxamide (PubChem CID 118731963) has the molecular formula C26H23ClN4O6 and a molecular weight of 522.95 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N-[4-methoxy-2-[[4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]phenyl]oxamide.
| Compound Name | N'-(2-chlorophenyl)-N-[4-methoxy-2-[[4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]phenyl]oxamide |
|---|---|
| PubChem CID | 118731963 |
| Molecular Formula | C26H23ClN4O6 |
| Molecular Weight | 522.95 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | N'-(2-chlorophenyl)-N-[4-methoxy-2-[[4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]phenyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)Nc2ccccc2Cl)c(C(=O)Nc2ccc(N3CCOCC3=O)cc2)c1 |
| InChI | InChI=1S/C26H23ClN4O6/c1-36-18-10-11-21(29-25(34)26(35)30-22-5-3-2-4-20(22)27)19(14-18)24(33)28-16-6-8-17(9-7-16)31-12-13-37-15-23(31)32/h2-11,14H,12-13,15H2,1H3,(H,28,33)(H,29,34)(H,30,35) |
| InChIKey | DBTJJCVRJNGSRK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.95 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|