C25H20FNO5 — CID 118733589
ethyl (2Z,5E)-6-[4-(4-fluorobenzoyl)-1-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate (PubChem CID 118733589) has the molecular formula C25H20FNO5 and a molecular weight of 433.44 g/mol. Its IUPAC name is ethyl (2Z,5E)-6-[4-(4-fluorobenzoyl)-1-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate.
| Compound Name | ethyl (2Z,5E)-6-[4-(4-fluorobenzoyl)-1-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate |
|---|---|
| PubChem CID | 118733589 |
| Molecular Formula | C25H20FNO5 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | ethyl (2Z,5E)-6-[4-(4-fluorobenzoyl)-1-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate |
| SMILES | CCOC(=O)/C(O)=C/C(=O)/C=C/c1cc(C(=O)c2ccc(F)cc2)cn1-c1ccccc1 |
| InChI | InChI=1S/C25H20FNO5/c1-2-32-25(31)23(29)15-22(28)13-12-21-14-18(16-27(21)20-6-4-3-5-7-20)24(30)17-8-10-19(26)11-9-17/h3-16,29H,2H2,1H3/b13-12+,23-15- |
| InChIKey | FKGPUWHLZAWVBY-UNMKBGRBSA-N |
| XLogP | 4.43 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|