C20H32O2 — CID 118736652
(1S,2R,3R,5R,6R,7R,8R)-5-[(4R)-4-hydroxy-6-methylhepta-1,5-dien-2-yl]-2,8-dimethyltricyclo[5.3.0.02,6]decan-3-ol (PubChem CID 118736652) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,2R,3R,5R,6R,7R,8R)-5-[(4R)-4-hydroxy-6-methylhepta-1,5-dien-2-yl]-2,8-dimethyltricyclo[5.3.0.02,6]decan-3-ol.
| Compound Name | (1S,2R,3R,5R,6R,7R,8R)-5-[(4R)-4-hydroxy-6-methylhepta-1,5-dien-2-yl]-2,8-dimethyltricyclo[5.3.0.02,6]decan-3-ol |
|---|---|
| PubChem CID | 118736652 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,2R,3R,5R,6R,7R,8R)-5-[(4R)-4-hydroxy-6-methylhepta-1,5-dien-2-yl]-2,8-dimethyltricyclo[5.3.0.02,6]decan-3-ol |
| SMILES | C=C(C[C@@H](O)C=C(C)C)[C@@H]1C[C@@H](O)[C@@]2(C)[C@@H]1[C@@H]1[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C20H32O2/c1-11(2)8-14(21)9-13(4)15-10-17(22)20(5)16-7-6-12(3)18(16)19(15)20/h8,12,14-19,21-22H,4,6-7,9-10H2,1-3,5H3/t12-,14+,15+,16+,17-,18-,19+,20+/m1/s1 |
| InChIKey | APELMYBILSZXIR-GYVXRYSJSA-N |
| XLogP | 3.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|