C18H18ClN5OS — CID 118755332
[4-[(4-amino-7-chloroquinazolin-2-yl)methyl]piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 118755332) has the molecular formula C18H18ClN5OS and a molecular weight of 387.90 g/mol. Its IUPAC name is [4-[(4-amino-7-chloroquinazolin-2-yl)methyl]piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[(4-amino-7-chloroquinazolin-2-yl)methyl]piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 118755332 |
| Molecular Formula | C18H18ClN5OS |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [4-[(4-amino-7-chloroquinazolin-2-yl)methyl]piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | Nc1nc(CN2CCN(C(=O)c3cccs3)CC2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H18ClN5OS/c19-12-3-4-13-14(10-12)21-16(22-17(13)20)11-23-5-7-24(8-6-23)18(25)15-2-1-9-26-15/h1-4,9-10H,5-8,11H2,(H2,20,21,22) |
| InChIKey | UUSLHBAQSRTCAI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |