C13H18N6O3S2 — CID 118761759
1-[5-(methanesulfonamido)-2-methylphenyl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea (PubChem CID 118761759) has the molecular formula C13H18N6O3S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-[5-(methanesulfonamido)-2-methylphenyl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea.
| Compound Name | 1-[5-(methanesulfonamido)-2-methylphenyl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea |
|---|---|
| PubChem CID | 118761759 |
| Molecular Formula | C13H18N6O3S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-[5-(methanesulfonamido)-2-methylphenyl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea |
| SMILES | Cc1ccc(NS(C)(=O)=O)cc1NC(=O)NCCSc1cn[nH]n1 |
| InChI | InChI=1S/C13H18N6O3S2/c1-9-3-4-10(18-24(2,21)22)7-11(9)16-13(20)14-5-6-23-12-8-15-19-17-12/h3-4,7-8,18H,5-6H2,1-2H3,(H2,14,16,20)(H,15,17,19) |
| InChIKey | XZSVZZJOVPPMDJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|