C14H20N6O3S2 — CID 118765299
1-[4-(propylsulfamoyl)phenyl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea (PubChem CID 118765299) has the molecular formula C14H20N6O3S2 and a molecular weight of 384.49 g/mol. Its IUPAC name is 1-[4-(propylsulfamoyl)phenyl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea.
| Compound Name | 1-[4-(propylsulfamoyl)phenyl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea |
|---|---|
| PubChem CID | 118765299 |
| Molecular Formula | C14H20N6O3S2 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-[4-(propylsulfamoyl)phenyl]-3-[2-(2H-triazol-4-ylsulfanyl)ethyl]urea |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=O)NCCSc2cn[nH]n2)cc1 |
| InChI | InChI=1S/C14H20N6O3S2/c1-2-7-17-25(22,23)12-5-3-11(4-6-12)18-14(21)15-8-9-24-13-10-16-20-19-13/h3-6,10,17H,2,7-9H2,1H3,(H2,15,18,21)(H,16,19,20) |
| InChIKey | KCQZZLUAEJMBDZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|